AA86937
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $47.00 | $33.00 | - + | |
250mg | 95% | in stock | $57.00 | $40.00 | - + | |
1g | 95% | in stock | $145.00 | $102.00 | - + | |
5g | 95% | in stock | $716.00 | $502.00 | - + | |
10g | 95% | in stock | $1,348.00 | $944.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA86937 |
Chemical Name: | 2,6-Bis(4,5-dihydrooxazol-2-yl)pyridine |
CAS Number: | 165125-95-1 |
Molecular Formula: | C11H11N3O2 |
Molecular Weight: | 217.2239 |
MDL Number: | MFCD28145681 |
SMILES: | C1CN=C(O1)c1cccc(n1)C1=NCCO1 |
Complexity: | 297 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.6 |
Chemical communications (Cambridge, England) 20121107
Acta crystallographica. Section E, Structure reports online 20110601
Organic & biomolecular chemistry 20101007
Inorganic chemistry 20100607
The Journal of organic chemistry 20050107
Journal of the American Chemical Society 20021218