AA88060
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $89.00 | $62.00 | - + | |
1g | 95% | in stock | $108.00 | $75.00 | - + | |
5g | 95% | in stock | $321.00 | $225.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA88060 |
Chemical Name: | Bis(2,4-dinitrophenyl) oxalate |
CAS Number: | 16536-30-4 |
Molecular Formula: | C14H6N4O12 |
Molecular Weight: | 422.217 |
MDL Number: | MFCD00010712 |
SMILES: | O=C(C(=O)Oc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])Oc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
Complexity: | 673 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 12 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.8 |
Analytica chimica acta 20110408
Journal of hazardous materials 20050930