AY09832
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | 2 weeks | $182.00 | $128.00 | - + | |
100mg | 95% | 2 weeks | $437.00 | $306.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY09832 |
Chemical Name: | 3-(2-(Pyridin-4-yl)ethyl)-1H-indole |
CAS Number: | 16571-49-6 |
Molecular Formula: | C15H14N2 |
Molecular Weight: | 222.2851 |
MDL Number: | MFCD00022775 |
SMILES: | n1ccc(cc1)CCc1c[nH]c2c1cccc2 |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.4 |
Journal of medicinal chemistry 20050127