AB79505
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $5.00 | - + | |
5g | 97% | in stock | $13.00 | $9.00 | - + | |
10g | 97% | in stock | $15.00 | $11.00 | - + | |
25g | 97% | in stock | $25.00 | $18.00 | - + | |
100g | 97% | in stock | $80.00 | $56.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79505 |
Chemical Name: | Tetraethyl methylenediphosphonate |
CAS Number: | 1660-94-2 |
Molecular Formula: | C9H22O6P2 |
Molecular Weight: | 288.2149 |
MDL Number: | MFCD00039887 |
SMILES: | CCOP(=O)(CP(=O)(OCC)OCC)OCC |
NSC Number: | 133889 |
Complexity: | 245 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 10 |
XLogP3: | 0.3 |
Chemical biology & drug design 20120501
European journal of medicinal chemistry 20120501
European journal of medicinal chemistry 20080501
The Journal of organic chemistry 20060317