AA88944
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $10.00 | $7.00 | - + | |
5g | 97% | in stock | $16.00 | $11.00 | - + | |
10g | 97% | in stock | $20.00 | $14.00 | - + | |
25g | 97% | in stock | $48.00 | $34.00 | - + | |
100g | 97% | in stock | $191.00 | $134.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA88944 |
Chemical Name: | O-Benzyl-l-tyrosine |
CAS Number: | 16652-64-5 |
Molecular Formula: | C16H17NO3 |
Molecular Weight: | 271.3111 |
MDL Number: | MFCD00002605 |
SMILES: | N[C@H](C(=O)O)Cc1ccc(cc1)OCc1ccccc1 |
Complexity: | 294 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | -0.1 |
Journal of medicinal chemistry 19981203