AB61247
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $267.00 | $187.00 | - + | |
250mg | 95% | in stock | $496.00 | $347.00 | - + | |
1g | 95% | in stock | $1,132.00 | $793.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61247 |
Chemical Name: | N-(Pyrimidin-2-yl)benzenesulfonamide |
CAS Number: | 16699-12-0 |
Molecular Formula: | C10H9N3O2S |
Molecular Weight: | 235.2624 |
MDL Number: | MFCD00447813 |
SMILES: | O=S(=O)(c1ccccc1)Nc1ncccn1 |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.6 |
Bioorganic & medicinal chemistry letters 20101101
Bioorganic & medicinal chemistry 20091101
Indian journal of pharmaceutical sciences 20090101