AA89417
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $16.00 | $11.00 | - + | |
100g | 98% | in stock | $19.00 | $13.00 | - + | |
500g | 98% | in stock | $47.00 | $33.00 | - + | |
1000g | 98% | in stock | $90.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89417 |
Chemical Name: | 6-Hydroxy-2-naphthoic acid |
CAS Number: | 16712-64-4 |
Molecular Formula: | C11H8O3 |
Molecular Weight: | 188.17941999999996 |
MDL Number: | MFCD00060070 |
SMILES: | Oc1ccc2c(c1)ccc(c2)C(=O)O |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.9 |
Journal of medicinal chemistry 20120412
Molecular pharmaceutics 20070101
Food additives and contaminants 20030301
Food additives and contaminants 20020501
Bioscience, biotechnology, and biochemistry 20011201
Journal of medicinal chemistry 19970411