AA89544
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $21.00 | $15.00 | - + | |
5g | 97% | in stock | $36.00 | $26.00 | - + | |
10g | 97% | in stock | $71.00 | $50.00 | - + | |
100g | 97% | in stock | $686.00 | $480.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89544 |
Chemical Name: | 1-(4-Methoxyphenyl)cyclopropanecarboxylic acid |
CAS Number: | 16728-01-1 |
Molecular Formula: | C11H12O3 |
Molecular Weight: | 192.2112 |
MDL Number: | MFCD00019223 |
SMILES: | COc1ccc(cc1)C1(CC1)C(=O)O |
NSC Number: | 158249 |
Complexity: | 225 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.7 |
The Journal of organic chemistry 20080118