AA89647
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $23.00 | $17.00 | - + | |
5g | 98% | in stock | $82.00 | $58.00 | - + | |
10g | 98% | in stock | $164.00 | $115.00 | - + | |
25g | 98% | in stock | $264.00 | $185.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89647 |
Chemical Name: | 6-Chloroindole-2-carboxylic acid |
CAS Number: | 16732-75-5 |
Molecular Formula: | C9H6ClNO2 |
Molecular Weight: | 195.6024 |
MDL Number: | MFCD01863157 |
SMILES: | Clc1ccc2c(c1)[nH]c(c2)C(=O)O |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.9 |
Journal of medicinal chemistry 20040506