AE81437
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $15.00 | $10.00 | - + | |
25mg | 98% | in stock | $43.00 | $30.00 | - + | |
250mg | 98% | in stock | $190.00 | $133.00 | - + | |
1g | 98% | in stock | $568.00 | $397.00 | - + | |
5g | 98% | in stock | $1,986.00 | $1,390.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE81437 |
Chemical Name: | Adelmidrol |
CAS Number: | 1675-66-7 |
Molecular Formula: | C13H26N2O4 |
Molecular Weight: | 274.3565 |
MDL Number: | MFCD00868853 |
SMILES: | OCCNC(=O)CCCCCCCC(=O)NCCO |
NSC Number: | 27132 |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 12 |
XLogP3: | -0.3 |
Journal of cellular and molecular medicine 20090601