AA89930
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $9.00 | $6.00 | - + | |
250mg | 95+% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $57.00 | $40.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA89930 |
Chemical Name: | 5,6-Dichloro-1h-indole-2,3-dione |
CAS Number: | 1677-48-1 |
Molecular Formula: | C8H3Cl2NO2 |
Molecular Weight: | 216.0209 |
MDL Number: | MFCD06797894 |
SMILES: | O=C1Nc2c(C1=O)cc(c(c2)Cl)Cl |
Complexity: | 269 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 20070419