AD67179
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $26.00 | $18.00 | - + | |
25g | 95% | in stock | $61.00 | $43.00 | - + | |
100g | 95% | in stock | $203.00 | $142.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD67179 |
Chemical Name: | (1S,4R)-Methyl 4-(tert-butoxycarbonylamino)cyclopent-2-enecarboxylate |
CAS Number: | 168683-02-1 |
Molecular Formula: | C12H19NO4 |
Molecular Weight: | 241.2836 |
MDL Number: | MFCD02259716 |
SMILES: | COC(=O)[C@@H]1C=C[C@@H](C1)NC(=O)OC(C)(C)C |
Complexity: | 330 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.6 |
Journal of medicinal chemistry 20011206