AA91247
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | >98.0%(HPLC) | in stock | $53.00 | $37.00 | - + | |
250mg | 95% | in stock | $90.00 | $63.00 | - + | |
1g | 95% | in stock | $193.00 | $136.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA91247 |
Chemical Name: | N4-(3-Bromophenyl)quinazoline-4,6-diamine |
CAS Number: | 169205-78-1 |
Molecular Formula: | C14H11BrN4 |
Molecular Weight: | 315.1679 |
MDL Number: | MFCD09908082 |
SMILES: | Brc1cccc(c1)Nc1ncnc2c1cc(N)cc2 |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.4 |
Journal of medicinal chemistry 20120308
European journal of medicinal chemistry 20120301
Bioorganic & medicinal chemistry 20110815
The Journal of pharmacology and experimental therapeutics 20100701
Journal of medicinal chemistry 20100311
Acta crystallographica. Section E, Structure reports online 20100201
European journal of medicinal chemistry 20091001
Nature chemical biology 20070401
Journal of medicinal chemistry 20060615
Journal of medicinal chemistry 20031204
Journal of medicinal chemistry 20030925
Journal of medicinal chemistry 20010816
Journal of medicinal chemistry 19970606
Journal of medicinal chemistry 19960105