AI38892
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $31.00 | $22.00 | - + | |
100g | 95% | in stock | $77.00 | $54.00 | - + | |
500g | 95% | in stock | $206.00 | $145.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI38892 |
Chemical Name: | 1,2:5,6-Di-O-isopropylidene-D-mannitol |
CAS Number: | 1707-77-3 |
Molecular Formula: | C12H22O6 |
Molecular Weight: | 262.2994799999999 |
MDL Number: | MFCD00003211 |
SMILES: | O[C@@H]([C@@H]([C@H]1COC(O1)(C)C)O)[C@H]1COC(O1)(C)C |
Complexity: | 273 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -0.5 |
Dalton transactions (Cambridge, England : 2003) 20110114
Archives of pharmacal research 20030901