AB45864
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $27.00 | $19.00 | - + | |
10g | 95% | in stock | $50.00 | $35.00 | - + | |
25g | 95% | in stock | $65.00 | $45.00 | - + | |
100g | 95% | in stock | $233.00 | $163.00 | - + | |
500g | 95% | in stock | $694.00 | $486.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45864 |
Chemical Name: | Dibenzyl phosphite |
CAS Number: | 17176-77-1 |
Molecular Formula: | C14H15O3P |
Molecular Weight: | 262.2409 |
MDL Number: | MFCD00004774 |
SMILES: | O=P(OCc1ccccc1)OCc1ccccc1 |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 1 |
Formal Charge: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3 |
Dibenzyl phosphonate is a versatile compound commonly employed in chemical synthesis as a crucial building block. Its unique chemical properties make it a valuable tool for organic chemists in various synthetic processes. One primary application of dibenzyl phosphonate is its role as a phosphonate protecting group. By utilizing dibenzyl phosphonate as a protective reagent, chemists can selectively shield specific functional groups in complex molecules during synthetic reactions. This enables precise control over the reaction outcomes and facilitates the synthesis of intricate organic compounds. Furthermore, dibenzyl phosphonate can participate in various transformations to introduce phosphonate groups into target molecules, serving as a key intermediate in the synthesis of phosphonate derivatives with diverse applications in medicinal chemistry, materials science, and other fields. Its compatibility with a wide range of synthetic methodologies highlights its significance as a valuable tool for chemists seeking to construct complex molecules with precision and efficiency.
Journal of natural products 20110425
International journal of molecular sciences 20110101
Journal of the American Chemical Society 20050406
Endocrine research 20021101