AB56129
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $19.00 | $14.00 | - + | |
100g | 98% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB56129 |
Chemical Name: | (S)-4-Benzyl-1,3-thiazolidine-2-thione |
CAS Number: | 171877-39-7 |
Molecular Formula: | C10H11NS2 |
Molecular Weight: | 209.33104 |
MDL Number: | MFCD06658216 |
SMILES: | S=C1SC[C@@H](N1)Cc1ccccc1 |
Complexity: | 187 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.9 |
2-Thiazolidinethione, 4-(phenylmethyl)-(4S)- is a highly versatile compound commonly employed in chemical synthesis. Its unique chemical structure and reactivity make it a valuable building block in the development of various chemical products. This compound is particularly useful in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals due to its ability to serve as a key intermediate in complex molecular transformations. With its distinct properties and flexibility in reactions, this compound plays a crucial role in the creation of diverse chemical formulations and materials.