AA91573
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $16.00 | $11.00 | - + | |
10mg | 95% | in stock | $28.00 | $19.00 | - + | |
50mg | 95% | in stock | $63.00 | $44.00 | - + | |
1g | 95% | in stock | $94.00 | $66.00 | - + | |
5g | 95% | in stock | $369.00 | $259.00 | - + | |
10g | 95% | in stock | $646.00 | $452.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA91573 |
Chemical Name: | (2E)-but-2-enedioic acid; bis((2S,4S,5S,7S)-5-amino-N-(2-carbamoyl-2,2-dimethylethyl)-4-hydroxy-7-{[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl}-8-methyl-2-(propan-2-yl)nonanamide) |
CAS Number: | 173334-58-2 |
Molecular Formula: | C64H110N6O16 |
Molecular Weight: | 1219.5888000000004 |
MDL Number: | MFCD10566724 |
SMILES: | OC(=O)/C=C/C(=O)O.COCCCOc1cc(ccc1OC)C[C@H](C(C)C)C[C@@H]([C@H](C[C@H](C(=O)NCC(C(=O)N)(C)C)C(C)C)O)N.COCCCOc1cc(ccc1OC)C[C@H](C(C)C)C[C@@H]([C@H](C[C@H](C(=O)NCC(C(=O)N)(C)C)C(C)C)O)N |
Complexity: | 836 |
Covalently-Bonded Unit Count: | 3 |
Defined Atom Stereocenter Count: | 8 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 86 |
Hydrogen Bond Acceptor Count: | 18 |
Hydrogen Bond Donor Count: | 10 |
Rotatable Bond Count: | 40 |
Journal of medicinal chemistry 20071004
The Journal of organic chemistry 20020614