AB80436
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98%(HPLC) | in stock | $24.00 | $17.00 | - + | |
5g | 97% | in stock | $33.00 | $23.00 | - + | |
25g | 97% | in stock | $74.00 | $52.00 | - + | |
100g | 97% | in stock | $193.00 | $135.00 | - + | |
500g | 97% | in stock | $898.00 | $629.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB80436 |
Chemical Name: | Z-Gly-ONp |
CAS Number: | 1738-86-9 |
Molecular Formula: | C16H14N2O6 |
Molecular Weight: | 330.2922 |
MDL Number: | MFCD00024663 |
SMILES: | O=C(Oc1ccc(cc1)[N+](=O)[O-])CNC(=O)OCc1ccccc1 |
NSC Number: | 405051 |
Complexity: | 436 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 2.7 |
Journal of medicinal chemistry 19860101