logo
Home  > 1-Butyl-3-methylimidazolium hexafluorophosphate

AB43313

174501-64-5 | 1-Butyl-3-methylimidazolium hexafluorophosphate

Packsize Purity Availability Price Discounted Price    Quantity
5g 97% in stock $14.00 $10.00 -   +
25g 97% in stock $14.00 $10.00 -   +
100g 97% in stock $36.00 $26.00 -   +
500g 97% in stock $149.00 $105.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB43313
Chemical Name: 1-Butyl-3-methylimidazolium hexafluorophosphate
CAS Number: 174501-64-5
Molecular Formula: C8H15F6N2P
Molecular Weight: 284.1823
MDL Number: MFCD03093295
SMILES: F[P+](F)(F)(F)(F)F.CCCCn1cc[n+](c1)C

 

Computed Properties
Complexity: 156  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 7  
Rotatable Bond Count: 3  

 

 

Upstream Synthesis Route 
  • 1-Butyl-3-Methylimidazolium Hexafluorophosphate, commonly referred to as BMIMPF6, is a versatile ionic liquid used extensively in chemical synthesis due to its unique properties. This compound serves as an efficient and environmentally friendly solvent in various organic reactions, enabling enhanced catalytic activity and selectivity. BMIMPF6 is particularly valued for its ability to facilitate the synthesis of organic compounds, such as pharmaceuticals, agrochemicals, and specialty chemicals, by providing a stable reaction environment that promotes efficient mixing of reactants and enhances reaction rates. Additionally, its high thermal stability and non-volatility make it an ideal medium for carrying out reactions at elevated temperatures without the risk of evaporation or degradation. In summary, 1-Butyl-3-Methylimidazolium Hexafluorophosphate plays a crucial role in advancing chemical synthesis processes by offering a sustainable and effective solvent option for a diverse range of applications.
Literature
FEATURED PRODUCTS