AA93290
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
10g | 98% | in stock | $30.00 | $21.00 | - + | |
25g | 98% | in stock | $69.00 | $48.00 | - + | |
50g | 98% | in stock | $125.00 | $87.00 | - + | |
100g | 98% | in stock | $226.00 | $158.00 | - + | |
500g | 98% | in stock | $1,103.00 | $772.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA93290 |
Chemical Name: | O-(2,4-Dinitrophenyl)hydroxylamine |
CAS Number: | 17508-17-7 |
Molecular Formula: | C6H5N3O5 |
Molecular Weight: | 199.121 |
MDL Number: | MFCD00075001 |
SMILES: | NOc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] |
NSC Number: | 148499 |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.7 |
The Journal of organic chemistry 20030905