AA94484
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $34.00 | $24.00 | - + | |
25g | 95% | in stock | $87.00 | $61.00 | - + | |
50g | 95% | in stock | $169.00 | $118.00 | - + | |
100g | 95% | in stock | $305.00 | $214.00 | - + | |
500g | 95% | in stock | $1,333.00 | $933.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA94484 |
Chemical Name: | 2-Amino-6-(methylsulfonyl)benzothiazole |
CAS Number: | 17557-67-4 |
Molecular Formula: | C8H8N2O2S2 |
Molecular Weight: | 228.2913 |
MDL Number: | MFCD00179133 |
SMILES: | Nc1nc2c(s1)cc(cc2)S(=O)(=O)C |
Complexity: | 312 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.3 |
Journal of medicinal chemistry 20110113
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Chemical research in toxicology 20050601
Journal of enzyme inhibition and medicinal chemistry 20030601
Bioorganic & medicinal chemistry letters 20010709