AA99223
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $25.00 | $17.00 | - + | |
5g | 96% | in stock | $33.00 | $23.00 | - + | |
25g | 96% | in stock | $65.00 | $45.00 | - + | |
100g | 96% | in stock | $161.00 | $113.00 | - + | |
500g | 96% | in stock | $393.00 | $275.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA99223 |
Chemical Name: | 2,3-Dihydro-9,10-dihydroxy-1,4-anthracenedione |
CAS Number: | 17648-03-2 |
Molecular Formula: | C14H10O4 |
Molecular Weight: | 242.2268 |
MDL Number: | MFCD00012251 |
SMILES: | O=C1CCC(=O)c2c1c(O)c1c(c2O)cccc1 |
NSC Number: | 42299 |
Complexity: | 342 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 2.8 |
Journal of medicinal chemistry 20110414