AA99900
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $6.00 | $4.00 | - + | |
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $12.00 | $9.00 | - + | |
10g | 98% | in stock | $21.00 | $15.00 | - + | |
25g | 98% | in stock | $29.00 | $20.00 | - + | |
100g | 98% | in stock | $88.00 | $62.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA99900 |
Chemical Name: | Levofloxacin hydrochloride |
CAS Number: | 177325-13-2 |
Molecular Formula: | C18H21ClFN3O4 |
Molecular Weight: | 397.8284 |
MDL Number: | MFCD03265511 |
SMILES: | CN1CCN(CC1)c1c(F)cc2c3c1OC[C@@H](n3cc(c2=O)C(=O)O)C.Cl |
Complexity: | 634 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
Drug metabolism and disposition: the biological fate of chemicals 20110501