AB00628
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $19.00 | $13.00 | - + | |
25g | 98% | in stock | $41.00 | $29.00 | - + | |
100g | 98% | in stock | $97.00 | $68.00 | - + | |
500g | 98% | in stock | $355.00 | $248.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB00628 |
Chemical Name: | (4-Carboxybutyl)triphenylphosphonium bromide |
CAS Number: | 17814-85-6 |
Molecular Formula: | C23H24BrO2P |
Molecular Weight: | 443.3132 |
MDL Number: | MFCD00011906 |
SMILES: | OC(=O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
NSC Number: | 147756 |
Complexity: | 372 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 8 |
(4-Carboxybutyl)triphenylphosphonium bromide is a key reagent widely utilized in chemical synthesis for its unique ability to act as a highly efficient phase transfer catalyst. This compound plays a crucial role in facilitating various organic reactions involving two immiscible phases, typically an organic and an aqueous phase. The presence of the carboxylic acid group provides enhanced water solubility, making this compound particularly useful in reactions where aqueous conditions are required.In chemical synthesis, (4-Carboxybutyl)triphenylphosphonium bromide is employed in a range of reactions including nucleophilic substitutions, alkylations, and ether formations. Its phase transfer catalysis property allows for the transfer of reactants from one phase to another, thereby enabling easier access to substrates that may not be soluble in the reaction medium. This leads to improved yields and selectivity in a variety of organic transformations.Moreover, the triphenylphosphonium moiety in this compound enhances the stability of reaction intermediates and helps accelerate the rate of certain chemical reactions. The versatility of (4-Carboxybutyl)triphenylphosphonium bromide in facilitating complex synthetic pathways makes it a valuable tool for synthetic chemists in pharmaceutical, agrochemical, and material science research.