179062-05-6 | 4-fluoro-2-nitro-5-(trifluoromethyl)aniline

Packsize	Purity	Availability	Price	Discounted Price
1g	98%	in stock	$35.00	$24.00
5g	98%	in stock	$65.00	$46.00
10g	98%	in stock	$113.00	$80.00
25g	98%	in stock	$281.00	$197.00

Description

• Catalog Number: AB01876
• Chemical Name: 4-fluoro-2-nitro-5-(trifluoromethyl)aniline
• CAS Number: 179062-05-6
• Molecular Formula: C7H4F4N2O2
• Molecular Weight: 224.1125
• MDL Number: MFCD03094267
• SMILES: Fc1cc([N+](=O)[O-])c(cc1C(F)(F)F)N

Upstream Synthesis Route

5-Amino-2-fluoro-4-nitrobenzotrifluoride is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in the production of various pharmaceuticals, agrochemicals, and materials due to its unique properties and reactivity. In organic synthesis, 5-Amino-2-fluoro-4-nitrobenzotrifluoride serves as a key building block in the preparation of complex molecular structures. Its amino and nitro functional groups make it a valuable intermediate for the synthesis of heterocyclic compounds and fluorinated organic molecules. Additionally, the trifluoromethyl group enhances the compound's stability and lipophilicity, making it ideal for designing bioactive compounds and drug candidates. Furthermore, the fluoro substituent provides unique opportunities for introducing fluorine atoms into target molecules, imparting desirable properties such as increased metabolic stability and improved pharmacokinetics. Overall, 5-Amino-2-fluoro-4-nitrobenzotrifluoride is an essential reagent in modern organic chemistry, enabling the efficient construction of diverse chemical structures with potential applications in various fields.