AB02068
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $69.00 | $48.00 | - + | |
5mg | 98% | in stock | $130.00 | $91.00 | - + | |
10mg | 98% | in stock | $235.00 | $164.00 | - + | |
25mg | 98% | in stock | $388.00 | $271.00 | - + | |
50mg | 98% | in stock | $658.00 | $460.00 | - + | |
100mg | 98% | in stock | $1,125.00 | $787.00 | - + | |
250mg | 98% | in stock | $2,050.00 | $1,435.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB02068 |
Chemical Name: | Lly-507 |
CAS Number: | 1793053-37-8 |
Molecular Formula: | C36H42N6O |
Molecular Weight: | 574.7582800000002 |
MDL Number: | MFCD28902312 |
SMILES: | N#Cc1cc(cc(c1)c1ccccc1N1CCN(CC1)CCn1cc(c2c1cccc2)C)C(=O)NCCCN1CCCC1 |
Complexity: | 935 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 43 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 10 |
XLogP3: | 5.4 |
Journal of medicinal chemistry 20160526
The Journal of biological chemistry 20150529
Current therapeutic research, clinical and experimental 19751101