AW11915
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $919.00 | $644.00 | - + | |
100mg | 95% | 1 week | $1,333.00 | $933.00 | - + | |
250mg | 95% | 1 week | $1,877.00 | $1,314.00 | - + | |
500mg | 95% | 1 week | $2,908.00 | $2,036.00 | - + | |
1g | 95% | 1 week | $3,706.00 | $2,594.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW11915 |
Chemical Name: | 3-(4-{[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy}phenyl)cyclobutane-1-carboxylic acid, Mixture of diastereomers |
CAS Number: | 1795516-65-2 |
Molecular Formula: | C20H17ClN2O4 |
Molecular Weight: | 384.813 |
MDL Number: | MFCD30730394 |
SMILES: | OC(=O)C1CC(C1)c1ccc(cc1)OCc1onc(n1)c1cccc(c1)Cl |