AA98794
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $28.00 | $19.00 | - + | |
2mg | 98% | in stock | $46.00 | $33.00 | - + | |
5mg | 98% | in stock | $68.00 | $48.00 | - + | |
10mg | 98% | in stock | $102.00 | $71.00 | - + | |
25mg | 98% | in stock | $170.00 | $119.00 | - + | |
50mg | 98% | in stock | $259.00 | $182.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA98794 |
Chemical Name: | MS023 |
CAS Number: | 1831110-54-3 |
Molecular Formula: | C17H25N3O |
Molecular Weight: | 287.3999 |
MDL Number: | MFCD29924734 |
SMILES: | NCCN(Cc1c[nH]cc1c1ccc(cc1)OC(C)C)C |
Complexity: | 290 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 2 |
Journal of medicinal chemistry 20161013
The Journal of physiology 19751101