AB43261
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $20.00 | $14.00 | - + | |
5g | 97% | in stock | $48.00 | $33.00 | - + | |
25g | 97% | in stock | $208.00 | $145.00 | - + | |
100g | 97% | in stock | $764.00 | $535.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43261 |
Chemical Name: | 4-Amino-1-Boc-piperidine-4-carboxylic acid |
CAS Number: | 183673-71-4 |
Molecular Formula: | C11H20N2O4 |
Molecular Weight: | 244.2875 |
MDL Number: | MFCD01318728 |
SMILES: | O=C(N1CCC(CC1)(N)C(=O)O)OC(C)(C)C |
Complexity: | 314 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -2.2 |
1-Boc-4-aminopiperidine-4-carboxylic acid, also known as 4-(tert-butoxycarbonyl)amino-1-piperidine-4-carboxylic acid, is a versatile compound widely used in chemical synthesis. With its unique structure, this compound plays a crucial role in organic chemistry reactions.One important application of 1-Boc-4-aminopiperidine-4-carboxylic acid is its use as a protecting group in peptide synthesis. The tert-butoxycarbonyl (Boc) group acts as a protecting group for the amine functionality of the piperidine ring. This protection allows for selective manipulation of other functional groups in the molecule without affecting the amine group. By strategically deprotecting the Boc group at specific stages of the synthesis, researchers can control the order and efficiency of peptide bond formation in a stepwise manner.Additionally, 1-Boc-4-aminopiperidine-4-carboxylic acid serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. Its presence in the molecular structure of these products imparts desirable properties and functionalities essential for their biological activity.In summary, the incorporation of 1-Boc-4-aminopiperidine-4-carboxylic acid in chemical synthesis enables precise control over reaction pathways, facilitating the efficient and selective synthesis of a wide range of valuable compounds.