AI41572
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97 | 2 weeks | $105.00 | $73.00 | - + | |
2mg | 97 | 2 weeks | $123.00 | $86.00 | - + | |
3mg | 97 | 2 weeks | $149.00 | $105.00 | - + | |
5mg | 97 | 2 weeks | $168.00 | $118.00 | - + | |
10mg | 97 | 2 weeks | $193.00 | $135.00 | - + | |
100mg | 97% | 2 weeks | $241.00 | $169.00 | - + | |
250mg | 97% | 2 weeks | $391.00 | $274.00 | - + | |
500mg | 97% | 2 weeks | $548.00 | $384.00 | - + | |
1g | 97% | 2 weeks | $765.00 | $535.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI41572 |
Chemical Name: | 2-((4-Nitrobenzyl)oxy)tetrahydro-2h-pyran |
CAS Number: | 18483-99-3 |
Molecular Formula: | C12H15NO4 |
Molecular Weight: | 237.2518 |
MDL Number: | MFCD27946518 |
SMILES: | [O-][N+](=O)c1ccc(cc1)COC1CCCCO1 |
Complexity: | 245 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 2.3 |
Beilstein journal of organic chemistry 20120101