AX59450
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $501.00 | $351.00 | - + | |
100mg | 95% | 1 week | $702.00 | $492.00 | - + | |
250mg | 95% | 1 week | $968.00 | $678.00 | - + | |
500mg | 95% | 1 week | $1,480.00 | $1,036.00 | - + | |
1g | 95% | 1 week | $1,877.00 | $1,314.00 | - + | |
2.5g | 95% | 1 week | $3,595.00 | $2,517.00 | - + | |
5g | 95% | 1 week | $5,282.00 | $3,697.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX59450 |
Chemical Name: | 1-[(tert-butoxy)carbonyl]-3,5-dimethylpiperidine-2-carboxylic acid, Mixture of diastereomers |
CAS Number: | 1888643-71-7 |
Molecular Formula: | C13H23NO4 |
Molecular Weight: | 257.326 |
MDL Number: | MFCD31559719 |
SMILES: | CC1CC(C)C(N(C1)C(=O)OC(C)(C)C)C(=O)O |