AB16488
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $12.00 | $9.00 | - + | |
5mg | 95% | in stock | $16.00 | $11.00 | - + | |
10mg | 95% | in stock | $29.00 | $20.00 | - + | |
25mg | 98% | in stock | $54.00 | $38.00 | - + | |
50mg | 98% | in stock | $70.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB16488 |
Chemical Name: | Ro 48-8071 fumarate |
CAS Number: | 189197-69-1 |
Molecular Formula: | C27H31BrFNO6 |
Molecular Weight: | 564.4405 |
MDL Number: | MFCD05865242 |
SMILES: | OC(=O)/C=C/C(=O)O.C=CCN(CCCCCCOc1ccc(c(c1)F)C(=O)c1ccc(cc1)Br)C |
Complexity: | 587 |
Covalently-Bonded Unit Count: | 2 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 14 |
Journal of medicinal chemistry 20120614
Bioorganic & medicinal chemistry letters 20090201
Journal of medicinal chemistry 20030717