AB46834
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $39.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46834 |
Chemical Name: | Paraquat dichloride |
CAS Number: | 1910-42-5 |
Molecular Formula: | C12H14Cl2N2 |
Molecular Weight: | 257.159 |
MDL Number: | MFCD09033906 |
SMILES: | C[n+]1ccc(cc1)c1cc[n+](cc1)C.[Cl-].[Cl-] |
1,1'-Dimethyl-4,4'-dipyridinium dichloride, commonly known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as an effective oxidizing agent in various organic reactions, particularly in the preparation of diverse organic compounds. With its unique chemical structure, $name$ facilitates the oxidation of a wide range of functional groups, making it a valuable tool for chemists in the laboratory.In chemical synthesis, $name$ plays a crucial role in facilitating the conversion of alcohols to carbonyl compounds, such as aldehydes and ketones. This transformation is essential in the production of numerous pharmaceuticals, fragrances, and fine chemicals. Additionally, $name$ is utilized in the oxidation of sulfides to sulfoxides and sulfones, enabling the synthesis of sulfoximines and related compounds.Furthermore, $name$ finds application in the oxidation of amines to nitro compounds, providing a pathway for the synthesis of various nitrogen-containing organic molecules. Its ability to facilitate such transformations with high efficiency and selectivity makes it an indispensable reagent in organic synthesis.Overall, the versatility and effectiveness of 1,1'-Dimethyl-4,4'-dipyridinium dichloride make it a valuable asset in the toolbox of synthetic chemists for the preparation of complex organic molecules with diverse functional groups.