AB51971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $16.00 | $11.00 | - + | |
2mg | 98% | in stock | $19.00 | $13.00 | - + | |
5mg | 98% | in stock | $23.00 | $16.00 | - + | |
250mg | 98% | in stock | $73.00 | $51.00 | - + | |
1g | 98% | in stock | $161.00 | $113.00 | - + | |
5g | 98% | in stock | $471.00 | $330.00 | - + | |
10g | 98% | in stock | $782.00 | $547.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51971 |
Chemical Name: | 1-Deoxynojirimycin |
CAS Number: | 19130-96-2 |
Molecular Formula: | C6H13NO4 |
Molecular Weight: | 163.1717 |
MDL Number: | MFCD00063474 |
SMILES: | OC[C@H]1NC[C@@H]([C@H]([C@@H]1O)O)O |
Complexity: | 132 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 1 |
XLogP3: | -2.3 |
The compound (2R,3R,4R,5S)-2-Hydroxymethyl-piperidine-3,4,5-triol is a versatile molecule frequently utilized in chemical synthesis for its unique structural properties. Its hydroxyl groups make it an excellent candidate for various reactions such as esterification, etherification, and acylation. Furthermore, the piperidine ring confers significant stability to the molecule, enabling it to serve as a robust scaffold for building more complex structures. In synthesis, this compound is often employed as a chiral building block, allowing for the creation of enantiomerically pure products with specific biological or pharmacological activities. Its multifunctional nature and chirality make it a valuable tool in the development of new pharmaceuticals, agrochemicals, and fine chemicals.