AB50395
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $62.00 | $44.00 | - + | |
5g | 97% | in stock | $289.00 | $203.00 | - + | |
10g | 97% | in stock | $525.00 | $368.00 | - + | |
25g | 97% | in stock | $1,022.00 | $716.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50395 |
Chemical Name: | 4-(4-Trifluoromethylphenyl)benzoic acid |
CAS Number: | 195457-71-7 |
Molecular Formula: | C14H9F3O2 |
Molecular Weight: | 266.2153 |
MDL Number: | MFCD03424606 |
SMILES: | OC(=O)c1ccc(cc1)c1ccc(cc1)C(F)(F)F |
Complexity: | 311 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.7 |
Journal of medicinal chemistry 20071004