AB08995
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $56.00 | $39.00 | - + | |
10g | 95% | in stock | $85.00 | $59.00 | - + | |
25g | 95% | in stock | $143.00 | $100.00 | - + | |
100g | 95% | in stock | $446.00 | $312.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB08995 |
Chemical Name: | 2-Acetamido-6-hydroxypurine |
CAS Number: | 19962-37-9 |
Molecular Formula: | C7H7N5O2 |
Molecular Weight: | 193.1628 |
MDL Number: | MFCD00078201 |
SMILES: | CC(=O)Nc1[nH]c(=O)c2c(n1)[nH]cn2 |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | -0.9 |
Nucleosides, nucleotides & nucleic acids 20070101
The Journal of organic chemistry 20060512