AB09550
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $4.00 | - + | |
5g | 95% | in stock | $7.00 | $5.00 | - + | |
10g | 95% | in stock | $11.00 | $8.00 | - + | |
25g | 95% | in stock | $21.00 | $15.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB09550 |
Chemical Name: | 1,2-O-Isopropylidene-alpha-d-xylofuranose |
CAS Number: | 20031-21-4 |
Molecular Formula: | C8H14O5 |
Molecular Weight: | 190.1938 |
MDL Number: | MFCD00063295 |
SMILES: | OC[C@H]1O[C@H]2[C@@H]([C@H]1O)OC(O2)(C)C |
Complexity: | 205 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -0.4 |
Bioorganic & medicinal chemistry letters 20110701
Carbohydrate research 20090612
Journal of medicinal chemistry 20081225
The Journal of organic chemistry 20071207
The Journal of organic chemistry 20060915