AB09634
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $52.00 | $36.00 | - + | |
25g | 97% | in stock | $229.00 | $160.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB09634 |
Chemical Name: | 6-Chloropurine ribonucleoside |
CAS Number: | 2004-06-0 |
Molecular Formula: | C10H11ClN4O4 |
Molecular Weight: | 286.6717 |
MDL Number: | MFCD00005738 |
SMILES: | OC[C@H]1OC([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2Cl |
Complexity: | 339 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.3 |
Bioorganic & medicinal chemistry letters 20121001
Organic letters 20090618
Bioorganic & medicinal chemistry 20071115
Bioorganic & medicinal chemistry letters 20070501
Nucleosides, nucleotides & nucleic acids 20030101
Bioorganic & medicinal chemistry 20020301
Journal of medicinal chemistry 19841101
Journal of medicinal chemistry 19821101
Journal of medicinal chemistry 19810801
Proceedings of the Society for Experimental Biology and Medicine. Society for Experimental Biology and Medicine (New York, N.Y.) 19690901