AB09633
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $20.00 | $14.00 | - + | |
5g | 95% | in stock | $26.00 | $18.00 | - + | |
25g | 95% | in stock | $29.00 | $21.00 | - + | |
100g | 95% | in stock | $112.00 | $79.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB09633 |
Chemical Name: | 6-Chloroguanosine |
CAS Number: | 2004-07-1 |
Molecular Formula: | C10H12ClN5O4 |
Molecular Weight: | 301.6864 |
MDL Number: | MFCD00005735 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(N)nc2Cl |
Complexity: | 367 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.1 |
Bioorganic & medicinal chemistry letters 20070501
The Journal of biological chemistry 20070420
Journal of medicinal chemistry 19841101