AB03915
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $28.00 | $19.00 | - + | |
1g | 97% | in stock | $323.00 | $226.00 | - + | |
5g | 97% | in stock | $946.00 | $662.00 | - + | |
10g | 97% | in stock | $1,505.00 | $1,054.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB03915 |
Chemical Name: | 4-Carboxyphthalimide |
CAS Number: | 20262-55-9 |
Molecular Formula: | C9H5NO4 |
Molecular Weight: | 191.1403 |
MDL Number: | MFCD00462255 |
SMILES: | O=C1NC(=O)c2c1cc(cc2)C(=O)O |
NSC Number: | 87998 |
Complexity: | 312 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.2 |
Bioorganic & medicinal chemistry letters 20101101
European journal of medicinal chemistry 20080301
Bioorganic & medicinal chemistry letters 20040621