AB04316
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $8.00 | $6.00 | - + | |
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $70.00 | $49.00 | - + | |
5g | 98% | in stock | $328.00 | $230.00 | - + | |
25g | 98% | in stock | $1,319.00 | $923.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB04316 |
Chemical Name: | 7-Methoxy-2-oxochromene-3-carboxylic acid |
CAS Number: | 20300-59-8 |
Molecular Formula: | C11H8O5 |
Molecular Weight: | 220.1782 |
MDL Number: | MFCD00452770 |
SMILES: | COc1ccc2c(c1)oc(=O)c(c2)C(=O)O |
Complexity: | 346 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
Bioorganic & medicinal chemistry 20131115
European journal of medicinal chemistry 20111001
Biochemistry 20080304