AB04633
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $60.00 | $42.00 | - + | |
1g | 95% | in stock | $63.00 | $45.00 | - + | |
5g | 95% | in stock | $236.00 | $165.00 | - + | |
25g | 95% | in stock | $1,106.00 | $775.00 | - + | |
100g | 95% | in stock | $3,867.00 | $2,707.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB04633 |
Chemical Name: | 2,6-Dichloro-9-isopropyl-9h-purine |
CAS Number: | 203436-45-7 |
Molecular Formula: | C8H8Cl2N4 |
Molecular Weight: | 231.08192000000003 |
MDL Number: | MFCD11047295 |
SMILES: | Clc1nc(Cl)c2c(n1)n(cn2)C(C)C |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.7 |
The Journal of organic chemistry 20081121