AB05610
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $12.00 | $8.00 | - + | |
1g | 95% | in stock | $18.00 | $13.00 | - + | |
5g | 95% | in stock | $65.00 | $46.00 | - + | |
10g | 95% | in stock | $125.00 | $88.00 | - + | |
25g | 95% | in stock | $230.00 | $161.00 | - + | |
50g | 95% | in stock | $438.00 | $307.00 | - + | |
100g | 95% | in stock | $627.00 | $439.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB05610 |
Chemical Name: | (S)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)acetic acid |
CAS Number: | 204688-61-9 |
Molecular Formula: | C11H19NO4 |
Molecular Weight: | 229.2729 |
MDL Number: | MFCD05861546 |
SMILES: | OC(=O)C[C@@H]1CCN(C1)C(=O)OC(C)(C)C |
The (S)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)acetic acid is a key intermediate in chemical synthesis processes, particularly in the field of pharmaceutical and organic chemistry. This compound serves as a versatile building block for the synthesis of various biologically active molecules due to its unique structural characteristics and reactivity.In chemical synthesis, (S)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)acetic acid is commonly utilized as a chiral precursor for the development of novel pharmaceutical compounds. Its chiral nature imparts specific stereochemical properties to the resulting products, making it a valuable tool in asymmetric synthesis strategies. Furthermore, the presence of the pyrrolidine ring in the molecule offers additional opportunities for structural diversification through functional group transformations and derivatization.The application of (S)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)acetic acid in chemical synthesis enables chemists to access complex molecular architectures efficiently and with high stereoselectivity. By incorporating this intermediate into synthetic sequences, researchers can access a wide range of chemical space, potentially leading to the discovery of new therapeutic agents or advanced materials.