AB17941
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $745.00 | $521.00 | - + | |
250mg | 95% | in stock | $1,270.00 | $889.00 | - + | |
1g | 95% | in stock | $1,608.00 | $1,125.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB17941 |
Chemical Name: | 2,2'-((2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethyl)azanediyl)diacetic acid compound with 4-methylbenzenesulfonic acid |
CAS Number: | 207612-93-9 |
Molecular Formula: | C17H20N2O9S |
Molecular Weight: | 428.4137 |
MDL Number: | MFCD16876287 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)O.OC(=O)CN(CC(=O)O)CCN1C(=O)C=CC1=O |