AB19459
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $18.00 | $13.00 | - + | |
25g | 98% | in stock | $38.00 | $27.00 | - + | |
100g | 98% | in stock | $106.00 | $75.00 | - + | |
500g | 98% | in stock | $479.00 | $335.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB19459 |
Chemical Name: | 2-Aminoadenosine |
CAS Number: | 2096-10-8 |
Molecular Formula: | C10H14N6O4 |
Molecular Weight: | 282.2560 |
MDL Number: | MFCD00053556 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(N)nc2N |
Complexity: | 363 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 2 |
XLogP3: | -1.4 |
Bioorganic & medicinal chemistry letters 20120615
Journal of medicinal chemistry 20110825
Nucleosides, nucleotides & nucleic acids 20080101
Organic & biomolecular chemistry 20070921
The Journal of biological chemistry 20070420
Nucleosides, nucleotides & nucleic acids 20060301
BMC biotechnology 20020101
Journal of Asian natural products research 20010101
Antiviral research 19900601
Journal of medicinal chemistry 19841101