AB20071
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $15.00 | $10.00 | - + | |
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $25.00 | $17.00 | - + | |
25g | 98% | in stock | $53.00 | $37.00 | - + | |
100g | 98% | in stock | $205.00 | $143.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB20071 |
Chemical Name: | N-(6-Oxo-6,7-dihydro-1h-purin-2-yl)isobutyramide |
CAS Number: | 21047-89-2 |
Molecular Formula: | C9H11N5O2 |
Molecular Weight: | 221.2159 |
MDL Number: | MFCD16038625 |
SMILES: | O=C(C(C)C)Nc1[nH]c(=O)c2c(n1)[nH]cn2 |
NSC Number: | 637538 |
Complexity: | 352 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.2 |
N-(6-Oxo-6,7-dihydro-1H-purin-2-yl)isobutyramide is a versatile chemical compound commonly used in chemical synthesis processes. This compound plays a crucial role as a building block in the development of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and properties make it a valuable intermediate in the synthesis of purine derivatives, which are key components in the production of antiviral and anticancer drugs. Additionally, N-(6-Oxo-6,7-dihydro-1H-purin-2-yl)isobutyramide can be employed in the preparation of complex heterocyclic compounds with diverse applications in medicinal chemistry and material science. Its integration in synthetic pathways underscores its importance as a valuable tool for chemical researchers and industries seeking to develop novel compounds with enhanced biological activities and material properties.
Bioorganicheskaia khimiia 20100101
Bioorganicheskaia khimiia 20090101