AI44863
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | in stock | $30.00 | $21.00 | - + | ||
5g | in stock | $65.00 | $45.00 | - + | ||
10g | in stock | $129.00 | $90.00 | - + | ||
25g | in stock | $232.00 | $162.00 | - + | ||
500g | in stock | $3,867.00 | $2,707.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI44863 |
Chemical Name: | D-Galactal |
CAS Number: | 21193-75-9 |
Molecular Formula: | C6H10O4 |
Molecular Weight: | 146.1412 |
MDL Number: | MFCD00038067 |
SMILES: | OC[C@H]1OC=C[C@H]([C@H]1O)O |
Complexity: | 134 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | -1 |
D-Galactal is a versatile compound that plays a significant role in chemical synthesis. As a carbohydrate derivative, D-Galactal is commonly used as a building block in the production of various pharmaceuticals, agrochemicals, and natural products. Its unique structure and reactivity make it a valuable intermediate in organic synthesis processes.In chemical synthesis, D-Galactal can serve as a precursor for the creation of complex molecules through various reactions such as glycosylation, oxidation, and reduction. Its ability to undergo selective transformations allows chemists to introduce specific functional groups at strategic positions, enabling the creation of intricate molecular structures with high precision.Moreover, D-Galactal's inherent chirality makes it a valuable tool in asymmetric synthesis, where the stereochemistry of the final product is critical. By utilizing D-Galactal as a chiral building block, chemists can access enantiomerically pure compounds with high efficiency and selectivity.Overall, the diverse applications of D-Galactal in chemical synthesis highlight its importance as a key component in the design and production of advanced materials and biologically active molecules.
Carbohydrate research 20120901
Analytical chemistry 20120515
The Journal of organic chemistry 20111202
Glycoconjugate journal 20111201
Chirality 20111001
Organic letters 20110218
Organic letters 20101015
Carbohydrate research 20100616
The Journal of organic chemistry 20090807
Organic letters 20090115
The Journal of organic chemistry 20081121
Carbohydrate research 20081013
Carbohydrate research 20080519
Nature protocols 20080101
Carbohydrate research 20070702
The Journal of organic chemistry 20070608
Organic letters 20070426
Carbohydrate research 20061127
Bioorganic & medicinal chemistry letters 20060815
Chemical communications (Cambridge, England) 20051121
The Journal of organic chemistry 20040903
Carbohydrate research 20040802
Organic letters 20031113
Organic & biomolecular chemistry 20031107
The Journal of organic chemistry 20031031
Carbohydrate research 20021105
Chemical communications (Cambridge, England) 20020621
Bioorganic & medicinal chemistry 20020601
Zhongguo Zhong xi yi jie he za zhi Zhongguo Zhongxiyi jiehe zazhi = Chinese journal of integrated traditional and Western medicine 20010901
Transplantation 19940327