AX58122
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $656.00 | $459.00 | - + | |
100mg | 95% | 1 week | $939.00 | $657.00 | - + | |
250mg | 95% | 1 week | $1,311.00 | $918.00 | - + | |
500mg | 95% | 1 week | $2,022.00 | $1,415.00 | - + | |
1g | 95% | 1 week | $2,568.00 | $1,798.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX58122 |
Chemical Name: | 8-methoxy-3-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, Mixture of diastereomers |
CAS Number: | 2138103-77-0 |
Molecular Formula: | C12H18ClNO |
Molecular Weight: | 227.7304 |
MDL Number: | MFCD31559225 |
SMILES: | COc1cccc2c1C(N)CC(C2)C.Cl |