AF35818
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $10.00 | $7.00 | - + | |
250mg | 98% | in stock | $20.00 | $14.00 | - + | |
1g | 98% | in stock | $45.00 | $31.00 | - + | |
5g | 98% | in stock | $130.00 | $91.00 | - + | |
10g | 98% | in stock | $240.00 | $168.00 | - + | |
25g | 98% | in stock | $550.00 | $385.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF35818 |
Chemical Name: | 2'-O-Methylguanosine |
CAS Number: | 2140-71-8 |
Molecular Formula: | C11H15N5O5 |
Molecular Weight: | 297.2673 |
MDL Number: | MFCD00057053 |
SMILES: | CO[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1nc(N)[nH]c2=O)CO |
Complexity: | 460 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.4 |
2'-O-Methylguanosine is a versatile nucleoside derivative that finds wide application in chemical synthesis, particularly in the field of medicinal chemistry and pharmaceutical research. This compound serves as a key building block in the synthesis of nucleic acid analogs and modified RNA molecules. Through strategic incorporation of 2'-O-Methylguanosine into oligonucleotide sequences, researchers can fine-tune the stability, binding affinity, and enzymatic properties of RNA molecules for various biological and therapeutic applications. Additionally, 2'-O-Methylguanosine is utilized in the development of modified RNA vaccines and antisense oligonucleotides, offering enhanced resistance to nuclease degradation and improved pharmacokinetic profiles. Its strategic use in chemical synthesis enables the creation of tailored nucleic acid structures with enhanced functionality and potential therapeutic benefits.
Bioorganic & medicinal chemistry letters 20100101
Biochemistry 20080205
BMC biochemistry 20070101
Nucleosides, nucleotides & nucleic acids 20060301
The Journal of biological chemistry 20050225
Journal of medicinal chemistry 20050224
Journal of medicinal chemistry 20040422
Bioorganic & medicinal chemistry letters 20030519
The Journal of antimicrobial chemotherapy 20030401
Nucleosides, nucleotides & nucleic acids 20030101
Genes to cells : devoted to molecular & cellular mechanisms 20020301
Biochemistry 20011127