AI44960
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 98% | in stock | $37.00 | $26.00 | - + | |
5g | 97% | in stock | $62.00 | $44.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI44960 |
Chemical Name: | 2'-O-Methylcytidine |
CAS Number: | 2140-72-9 |
Molecular Formula: | C10H15N3O5 |
Molecular Weight: | 257.2432 |
MDL Number: | MFCD11519076 |
SMILES: | CO[C@@H]1[C@H](O)[C@H](O[C@H]1n1ccc(nc1=O)N)CO |
Complexity: | 397 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.6 |
Organic & biomolecular chemistry 20100507
Biology direct 20100101
BMC plant biology 20100101
Bioorganic & medicinal chemistry 20080301
Journal of molecular biology 20080125
BMC molecular biology 20070101
Antimicrobial agents and chemotherapy 20050501
Journal of medicinal chemistry 20050224
The Journal of biological chemistry 20031205
The Journal of biological chemistry 20030404
Acta biochimica Polonica 20030101
Journal of combinatorial chemistry 20030101
RNA (New York, N.Y.) 20020501
Biochemistry 20011127